2-CHLORO-4-(CHLOROMETHYL)-1,3-OXAZOLE

pro_cas
1240621-63-9
pro_cdbregno
CCD03261108
pro_formula
C4 H3 Cl2 N O
pro_molWeight
151.98

basic_info

Product_Name: 2-CHLORO-4-(CHLOROMETHYL)-1,3-OXAZOLE
CAS: 1240621-63-9
EnglishSynonyms: 2-CHLORO-4-(CHLOROMETHYL)-1,3-OXAZOLE ; 2-CHLORO-4-(CHLOROMETHYL)OXAZOLE
pro_mdlNumber: MFCD16989393
pro_acceptors: 2
pro_donors: 0
pro_smile: c1c(nc(o1)Cl)CCl
InChi: InChI=1S/C4H3Cl2NO/c5-1-3-2-8-4(6)7-3/h2H,1H2
InChiKey: InChIKey=XZFNORUVJGMDCZ-UHFFFAOYSA-N