2,4-DICHLOROOXAZOLE

pro_cas
1240603-50-2
pro_cdbregno
CCD03261110
pro_formula
C3 H Cl2 N O
pro_molWeight
137.953

basic_info

Product_Name: 2,4-DICHLOROOXAZOLE
CAS: 1240603-50-2
EnglishSynonyms: 2,4-DICHLOROOXAZOLE
pro_mdlNumber: MFCD16989395
pro_acceptors: 2
pro_donors: 0
pro_smile: c1c(nc(o1)Cl)Cl
InChi: InChI=1S/C3HCl2NO/c4-2-1-7-3(5)6-2/h1H
InChiKey: InChIKey=XSACQZSHYVDIBA-UHFFFAOYSA-N