5-(CHLOROMETHYL)-2-(3-METHOXYPHENYL)-4-METHYL-1,3-OXAZOLE

pro_cas
1206978-70-2
pro_cdbregno
CCD03261838
pro_formula
C12 H12 Cl N O2
pro_molWeight
237.685

basic_info

Product_Name: 5-(CHLOROMETHYL)-2-(3-METHOXYPHENYL)-4-METHYL-1,3-OXAZOLE
CAS: 1206978-70-2
EnglishSynonyms: OXAZOLE, 5-(CHLOROMETHYL)-2-(3-METHOXYPHENYL)-4-METHYL- ; 5-(CHLOROMETHYL)-2-(3-METHOXYPHENYL)-4-METHYL-1,3-OXAZOLE
pro_mdlNumber: MFCD16990123
pro_acceptors: 3
pro_donors: 0
pro_smile: Cc1c(oc(n1)c2cccc(c2)OC)CCl
InChi: InChI=1S/C12H12ClNO2/c1-8-11(7-13)16-12(14-8)9-4-3-5-10(6-9)15-2/h3-6H,7H2,1-2H3
InChiKey: InChIKey=MVZOQRLNQMHDJX-UHFFFAOYSA-N