5-METHYL-4-PHENYL-OXAZOLE

pro_cas
1008-28-2
pro_cdbregno
CCD03261849
pro_formula
C10 H9 N O
pro_molWeight
159.187

basic_info

Product_Name: 5-METHYL-4-PHENYL-OXAZOLE
CAS: 1008-28-2
EnglishSynonyms: 5-METHYL-4-PHENYL-OXAZOLE ; OXAZOLE, 5-METHYL-4-PHENYL-
pro_mdlNumber: MFCD16990134
pro_acceptors: 2
pro_donors: 0
pro_smile: Cc1c(nco1)c2ccccc2
InChi: InChI=1S/C10H9NO/c1-8-10(11-7-12-8)9-5-3-2-4-6-9/h2-7H,1H3
InChiKey: InChIKey=LWBCTCYKAUXFNI-UHFFFAOYSA-N