2-ETHOXY-4-PHENYLOXAZOL-5-AMINE

pro_cas
1240599-36-3
pro_cdbregno
CCD03261860
pro_formula
C11 H12 N2 O2
pro_molWeight
204.228

basic_info

Product_Name: 2-ETHOXY-4-PHENYLOXAZOL-5-AMINE
CAS: 1240599-36-3
EnglishSynonyms: 2-ETHOXY-4-PHENYLOXAZOL-5-AMINE
pro_mdlNumber: MFCD16990145
pro_acceptors: 4
pro_donors: 1
pro_smile: CCOc1nc(c(o1)N)c2ccccc2
InChi: InChI=1S/C11H12N2O2/c1-2-14-11-13-9(10(12)15-11)8-6-4-3-5-7-8/h3-7H,2,12H2,1H3
InChiKey: InChIKey=YVGGGDUSNMGZFT-UHFFFAOYSA-N