N,N-DIMETHYL-1-(1,2,3,4-TETRAHYDROQUINOLIN-2-YL)METHANAMINE

pro_cas
1701-48-0
pro_cdbregno
CCD03262520
pro_formula
C12 H18 N2
pro_molWeight
190.288

basic_info

Product_Name: N,N-DIMETHYL-1-(1,2,3,4-TETRAHYDROQUINOLIN-2-YL)METHANAMINE
CAS: 1701-48-0
EnglishSynonyms: 2-QUINOLINEMETHANAMINE, 1,2,3,4-TETRAHYDRO-N,N-DIMETHYL- ; DIMETHYL(1,2,3,4-TETRAHYDROQUINOLIN-2-YLMETHYL)AMINE ; N,N-DIMETHYL-N-(1,2,3,4-TETRAHYDROQUINOLIN-2-YLMETHYL)AMINE ; 1,2,3,4-TETRAHYDRO-N,N-DIMETHYL-2-QUINOLINEMETHANAMINE ; N,N-DIMETHYL-1-(1,2,3,4-TETRAHYDROQUINOLIN-2-YL)METHANAMINE
pro_mdlNumber: MFCD16990807
pro_acceptors: 2
pro_donors: 1
pro_smile: CN(C)CC1CCc2ccccc2N1
InChi: InChI=1S/C12H18N2/c1-14(2)9-11-8-7-10-5-3-4-6-12(10)13-11/h3-6,11,13H,7-9H2,1-2H3
InChiKey: InChIKey=JNRVQHYXILJMRE-UHFFFAOYSA-N