7-CHLORO-3-(4-METHOXYPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE

pro_cas
pro_cdbregno
CCD03263145
pro_formula
C12 H8 Cl N3 O2
pro_molWeight
261.667

basic_info

Product_Name: 7-CHLORO-3-(4-METHOXYPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE
EnglishSynonyms: 7-CHLORO-3-(4-METHOXYPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE
pro_mdlNumber: MFCD16991432
pro_acceptors: 5
pro_donors: 0
pro_smile: COc1ccc(cc1)c2c3c(c(ncn3)Cl)on2
InChi: InChI=1S/C12H8ClN3O2/c1-17-8-4-2-7(3-5-8)9-10-11(18-16-9)12(13)15-6-14-10/h2-6H,1H3
InChiKey: InChIKey=XNVHQZNNEGMSRH-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.