7-CHLORO-3-(3-FLUOROPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE

pro_cas
pro_cdbregno
CCD03263146
pro_formula
C11 H5 Cl F N3 O
pro_molWeight
249.632

basic_info

Product_Name: 7-CHLORO-3-(3-FLUOROPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE
EnglishSynonyms: 7-CHLORO-3-(3-FLUOROPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE
pro_mdlNumber: MFCD16991433
pro_acceptors: 4
pro_donors: 0
pro_smile: c1cc(cc(c1)F)c2c3c(c(ncn3)Cl)on2
InChi: InChI=1S/C11H5ClFN3O/c12-11-10-9(14-5-15-11)8(16-17-10)6-2-1-3-7(13)4-6/h1-5H
InChiKey: InChIKey=YZJSAXXEKIXJRF-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.