7-METHYL-5-[(PYRIDIN-3-YLMETHYL)-AMINO]-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03265149
pro_formula
C12H12N6O
pro_molWeight
256.268

basic_info

Product_Name: 7-METHYL-5-[(PYRIDIN-3-YLMETHYL)-AMINO]-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-METHYL-5-[(PYRIDIN-3-YLMETHYL)-AMINO]-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16993436
pro_acceptors: 7
pro_donors: 2
pro_smile: CC1=CC=2N(C(=N1)NCC=1C=NC=CC1)C(NN2)=O
InChi: InChI=1S/C12H12N6O/c1-8-5-10-16-17-12(19)18(10)11(15-8)14-7-9-3-2-4-13-6-9/h2-6H,7H2,1H3,(H,14,15)(H,17,19)
InChiKey: InChIKey=OJABIYYHYSTDEN-UHFFFAOYSA-N