C15 H21 B O3


CAS: 1035690-24-4
pro_mdlNumber: MFCD16994464
pro_acceptors: 3
pro_donors: 0
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2cccc(c2)OC3CC3
InChi: InChI=1S/C15H21BO3/c1-14(2)15(3,4)19-16(18-14)11-6-5-7-13(10-11)17-12-8-9-12/h5-7,10,12H,8-9H2,1-4H3