2-(2-CYCLOPROPOXY-5-FLUOROPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE

pro_cas
1079402-44-0
pro_cdbregno
CCD03266650
pro_formula
C15 H20 B F O3
pro_molWeight
278.129

basic_info

Product_Name: 2-(2-CYCLOPROPOXY-5-FLUOROPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE
CAS: 1079402-44-0
EnglishSynonyms: 2-(2-CYCLOPROPOXY-5-FLUOROPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE
pro_mdlNumber: MFCD16994937
pro_acceptors: 3
pro_donors: 0
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2cc(ccc2OC3CC3)F
InChi: InChI=1S/C15H20BFO3/c1-14(2)15(3,4)20-16(19-14)12-9-10(17)5-8-13(12)18-11-6-7-11/h5,8-9,11H,6-7H2,1-4H3
InChiKey: InChIKey=QDUDUXYJYNVHFW-UHFFFAOYSA-N