(1-PHENYL-1H-PYRROL-2-YL)BORONIC ACID

pro_cas
1254065-74-1
pro_cdbregno
CCD03267160
pro_formula
C10 H10 B N O2
pro_molWeight
187.005

basic_info

Product_Name: (1-PHENYL-1H-PYRROL-2-YL)BORONIC ACID
CAS: 1254065-74-1
EnglishSynonyms: 1-PHENYL-PYRROL-2-YLBORONIC ACID ; (1-PHENYL-1H-PYRROL-2-YL)BORONIC ACID
pro_mdlNumber: MFCD16995447
pro_acceptors: 3
pro_donors: 2
pro_smile: B(c1cccn1c2ccccc2)(O)O
InChi: InChI=1S/C10H10BNO2/c13-11(14)10-7-4-8-12(10)9-5-2-1-3-6-9/h1-8,13-14H
InChiKey: InChIKey=ZYLQQRODXKJUNX-UHFFFAOYSA-N