METHANESULFONAMIDE, N-[4-[[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINO]PHENYL]-

pro_cas
1201644-32-7
pro_cdbregno
CCD03267258
pro_formula
C19 H25 B N2 O4 S
pro_molWeight
388.293

basic_info

Product_Name: METHANESULFONAMIDE, N-[4-[[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINO]PHENYL]-
CAS: 1201644-32-7
EnglishSynonyms: METHANESULFONAMIDE, N-[4-[[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]AMINO]PHENYL]- ; N-(4-(3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYLAMINO)PHENYL)METHANESULFONAMIDE
pro_mdlNumber: MFCD16995545
pro_acceptors: 6
pro_donors: 2
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2cccc(c2)Nc3ccc(cc3)NS(=O)(=O)C
InChi: InChI=1S/C19H25BN2O4S/c1-18(2)19(3,4)26-20(25-18)14-7-6-8-17(13-14)21-15-9-11-16(12-10-15)22-27(5,23)24/h6-13,21-22H,1-5H3
InChiKey: InChIKey=YLJAEMFZWBDWID-UHFFFAOYSA-N