SYNTHON-LAB SL094890

pro_cas
pro_cdbregno
CCD03283159
pro_formula
C26 H21 N3 O2 S
pro_molWeight
439.537

basic_info

Product_Name: SYNTHON-LAB SL094890
EnglishSynonyms: SYNTHON-LAB SL094890
pro_mdlNumber: MFCD17011471
pro_acceptors: 5
pro_donors: 0
pro_smile: Cc1ccc(cc1)COc2ccc(cc2)/C=c\3/c(=O)n4c(s3)nc(n4)c5cccc(c5)C
InChi: InChI=1S/C26H21N3O2S/c1-17-6-8-20(9-7-17)16-31-22-12-10-19(11-13-22)15-23-25(30)29-26(32-23)27-24(28-29)21-5-3-4-18(2)14-21/h3-15H,16H2,1-2H3/b23-15-
InChiKey: InChIKey=SNWDRWPNLLCYIH-HAHDFKILSA-N

* If the product has intellectual property rights, a license granted is must or contact us.