SYNTHON-LAB SL094898

pro_cas
pro_cdbregno
CCD03283160
pro_formula
C20 H16 N4 O6 S
pro_molWeight
440.434

basic_info

Product_Name: SYNTHON-LAB SL094898
EnglishSynonyms: SYNTHON-LAB SL094898
pro_mdlNumber: MFCD17011472
pro_acceptors: 10
pro_donors: 0
pro_smile: COc1cc(cc(c1OC)OC)c2nc3n(n2)c(=O)/c(=C\c4ccc(cc4)[N+](=O)[O-])/s3
InChi: InChI=1S/C20H16N4O6S/c1-28-14-9-12(10-15(29-2)17(14)30-3)18-21-20-23(22-18)19(25)16(31-20)8-11-4-6-13(7-5-11)24(26)27/h4-10H,1-3H3/b16-8+
InChiKey: InChIKey=JVPZFOAMCPPYJZ-LZYBPNLTSA-N

* If the product has intellectual property rights, a license granted is must or contact us.