SYNTHON-LAB SL094901

pro_cas
pro_cdbregno
CCD03283162
pro_formula
C22 H21 Cl N4 O2 S
pro_molWeight
440.953

basic_info

Product_Name: SYNTHON-LAB SL094901
EnglishSynonyms: SYNTHON-LAB SL094901
pro_mdlNumber: MFCD17011474
pro_acceptors: 6
pro_donors: 1
pro_smile: Cc1ccc(cc1)/C=C(\C(=O)N2CCOCC2)/Sc3[nH]nc(n3)c4cccc(c4)Cl
InChi: InChI=1S/C22H21ClN4O2S/c1-15-5-7-16(8-6-15)13-19(21(28)27-9-11-29-12-10-27)30-22-24-20(25-26-22)17-3-2-4-18(23)14-17/h2-8,13-14H,9-12H2,1H3,(H,24,25,26)/b19-13+
InChiKey: InChIKey=KJVDZWIJUVRPRZ-CPNJWEJPSA-N

* If the product has intellectual property rights, a license granted is must or contact us.