SYNTHON-LAB SL094907

pro_cas
pro_cdbregno
CCD03283163
pro_formula
C25 H19 N3 O3 S
pro_molWeight
441.509

basic_info

Product_Name: SYNTHON-LAB SL094907
EnglishSynonyms: SYNTHON-LAB SL094907
pro_mdlNumber: MFCD17011475
pro_acceptors: 6
pro_donors: 0
pro_smile: COc1ccc(cc1OC)c2nc3n(n2)c(=O)/c(=C/c4ccc(cc4)c5ccccc5)/s3
InChi: InChI=1S/C25H19N3O3S/c1-30-20-13-12-19(15-21(20)31-2)23-26-25-28(27-23)24(29)22(32-25)14-16-8-10-18(11-9-16)17-6-4-3-5-7-17/h3-15H,1-2H3/b22-14-
InChiKey: InChIKey=KWWPOQHBTWNDPR-HMAPJEAMSA-N

* If the product has intellectual property rights, a license granted is must or contact us.