4-CHLORO-8-ETHYL-5H-PYRIMIDO[5,4-B]INDOLE

pro_cas
549488-49-5
pro_cdbregno
CCD03284663
pro_formula
C12 H10 Cl N3
pro_molWeight
231.685

basic_info

Product_Name: 4-CHLORO-8-ETHYL-5H-PYRIMIDO[5,4-B]INDOLE
CAS: 549488-49-5
EnglishSynonyms: 5H-PYRIMIDO[5,4-B]INDOLE, 4-CHLORO-8-ETHYL- ; 4-CHLORO-8-ETHYL-5H-PYRIMIDO[5,4-B]INDOLE
pro_mdlNumber: MFCD17013024
pro_acceptors: 3
pro_donors: 1
pro_smile: CCc1ccc2c(c1)c3c([nH]2)c(ncn3)Cl
InChi: InChI=1S/C12H10ClN3/c1-2-7-3-4-9-8(5-7)10-11(16-9)12(13)15-6-14-10/h3-6,16H,2H2,1H3
InChiKey: InChIKey=GKMSSWWZJNSQKC-UHFFFAOYSA-N