DIPHENYLBORYL TRIFLUOROMETHANESULFONATE

pro_cas
100696-94-4
pro_cdbregno
CCD03284885
pro_formula
C13 H10 B F3 O3 S
pro_molWeight
314.09

basic_info

Product_Name: DIPHENYLBORYL TRIFLUOROMETHANESULFONATE
CAS: 100696-94-4
EnglishSynonyms: DIPHENYLBORYL TRIFLUOROMETHANESULFONATE
pro_mdlNumber: MFCD17013253
pro_acceptors: 3
pro_donors: 0
pro_smile: B(c1ccccc1)(c2ccccc2)OS(=O)(=O)C(F)(F)F
InChi: InChI=1S/C13H10BF3O3S/c15-13(16,17)21(18,19)20-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
InChiKey: InChIKey=RIQHFVSUHYHHKG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.