CYCLOHEXYLAMINO(CYCLOHEXYLIDENE)ACETONITRILE

pro_cas
63364-29-4
pro_cdbregno
CCD03284903
pro_formula
C14 H22 N2
pro_molWeight
218.342

basic_info

Product_Name: CYCLOHEXYLAMINO(CYCLOHEXYLIDENE)ACETONITRILE
CAS: 63364-29-4
EnglishSynonyms: CYCLOHEXYLAMINO(CYCLOHEXYLIDENE)ACETONITRILE
pro_mdlNumber: MFCD17013273
pro_acceptors: 2
pro_donors: 1
pro_smile: C1CCC(CC1)NC(=C2CCCCC2)C#N
InChi: InChI=1S/C14H22N2/c15-11-14(12-7-3-1-4-8-12)16-13-9-5-2-6-10-13/h13,16H,1-10H2
InChiKey: InChIKey=DLMMCUYZHQIYML-UHFFFAOYSA-N