6,6-DIMETHYL-4,8-DIOXASPIRO[2.5]OCT-1-ENE

pro_cas
60935-22-0
pro_cdbregno
CCD03285139
pro_formula
C8 H12 O2
pro_molWeight
140.181

basic_info

Product_Name: 6,6-DIMETHYL-4,8-DIOXASPIRO[2.5]OCT-1-ENE
CAS: 60935-22-0
EnglishSynonyms: 6,6-DIMETHYL-4,8-DIOXASPIRO[2.5]OCT-1-ENE
pro_mdlNumber: MFCD17013518
pro_acceptors: 2
pro_donors: 0
pro_smile: CC1(COC2(C=C2)OC1)C
InChi: InChI=1S/C8H12O2/c1-7(2)5-9-8(3-4-8)10-6-7/h3-4H,5-6H2,1-2H3
InChiKey: InChIKey=AINMINDCBBSFAO-UHFFFAOYSA-N