ISOQUINOLINE, 1-(4-FLUOROPHENYL)-1,2,3,4-TETRAHYDRO-, HYDROCHLORIDE

pro_cas
33769-41-4
pro_cdbregno
CCD03286926
pro_formula
C15 H14 F N . Cl H
pro_molWeight
263.741

basic_info

Product_Name: ISOQUINOLINE, 1-(4-FLUOROPHENYL)-1,2,3,4-TETRAHYDRO-, HYDROCHLORIDE
CAS: 33769-41-4
EnglishSynonyms: ISOQUINOLINE, 1-(4-FLUOROPHENYL)-1,2,3,4-TETRAHYDRO-, HYDROCHLORIDE ; 1-(4-FLUOROPHENYL)-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE
pro_mdlNumber: MFCD17015483
pro_acceptors: 1
pro_donors: 1
pro_smile: c1ccc2c(c1)CCNC2c3ccc(cc3)F.Cl
InChi: InChI=1S/C15H14FN.ClH/c16-13-7-5-12(6-8-13)15-14-4-2-1-3-11(14)9-10-17-15;/h1-8,15,17H,9-10H2;1H
InChiKey: InChIKey=HVVJGYUAQQALSJ-UHFFFAOYSA-N