WUXIAPPTEC WX110291-001

pro_cas
pro_cdbregno
CCD03287685
pro_formula
C10H17NO4
pro_molWeight
215.247

basic_info

Product_Name: WUXIAPPTEC WX110291-001
EnglishSynonyms: WUXIAPPTEC WX110291-010 ; WUXIAPPTEC WX110291-005 ; WUXIAPPTEC WX110291-001
pro_mdlNumber: MFCD17016539
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)C1OCCC2NCCOC12
InChi: InChI=1S/C10H17NO4/c1-2-13-10(12)9-8-7(3-5-14-9)11-4-6-15-8/h7-9,11H,2-6H2,1H3
InChiKey: InChIKey=JAWUPRUTGJTKQU-UHFFFAOYSA-N