WUXIAPPTEC WX110292-001

pro_cas
pro_cdbregno
CCD03287686
pro_formula
C10H17NO4
pro_molWeight
215.247

basic_info

Product_Name: WUXIAPPTEC WX110292-001
EnglishSynonyms: WUXIAPPTEC WX110292-005 ; WUXIAPPTEC WX110292-001 ; WUXIAPPTEC WX110292-010
pro_mdlNumber: MFCD17016540
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)C1COCC2NCCOC12
InChi: InChI=1S/C10H17NO4/c1-2-14-10(12)7-5-13-6-8-9(7)15-4-3-11-8/h7-9,11H,2-6H2,1H3
InChiKey: InChIKey=ODMMQFGAPSWHJG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.