WUXIAPPTEC WX110293-001

pro_cas
pro_cdbregno
CCD03287687
pro_formula
C10H17NO4
pro_molWeight
215.247

basic_info

Product_Name: WUXIAPPTEC WX110293-001
EnglishSynonyms: WUXIAPPTEC WX110293-010 ; WUXIAPPTEC WX110293-001 ; WUXIAPPTEC WX110293-005
pro_mdlNumber: MFCD17016541
pro_acceptors: 5
pro_donors: 1
pro_smile: CCOC(=O)C1CC2NCCOC2CO1
InChi: InChI=1S/C10H17NO4/c1-2-13-10(12)8-5-7-9(6-15-8)14-4-3-11-7/h7-9,11H,2-6H2,1H3
InChiKey: InChIKey=NSBXVBPAJKAUKO-UHFFFAOYSA-N