WUXIAPPTEC WX125064-001

pro_cas
pro_cdbregno
CCD03287902
pro_formula
C17H17BrN2O2S
pro_molWeight
393.303

basic_info

Product_Name: WUXIAPPTEC WX125064-001
EnglishSynonyms: WUXIAPPTEC WX125064-010 ; WUXIAPPTEC WX125064-005 ; WUXIAPPTEC WX125064-001
pro_mdlNumber: MFCD17016853
pro_acceptors: 4
pro_donors: 0
pro_smile: BrC1=NC2=C(S1)C1CCCC(C2)N1C(=O)OCC1=CC=CC=C1
InChi: InChI=1S/C17H17BrN2O2S/c18-16-19-13-9-12-7-4-8-14(15(13)23-16)20(12)17(21)22-10-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2
InChiKey: InChIKey=FDFSJIMVFGUUBK-UHFFFAOYSA-N