N-(2,3-DICHLOROPHENYL)-6-(METHYLAMINO)PYRIDAZINE-3-CARBOXAMIDE

pro_cas
pro_cdbregno
CCD03316301
pro_formula
C12 H10 Cl2 N4 O
pro_molWeight
297.144

basic_info

Product_Name: N-(2,3-DICHLOROPHENYL)-6-(METHYLAMINO)PYRIDAZINE-3-CARBOXAMIDE
EnglishSynonyms: N-(2,3-DICHLOROPHENYL)-6-(METHYLAMINO)PYRIDAZINE-3-CARBOXAMIDE
pro_mdlNumber: MFCD17036894
pro_acceptors: 5
pro_donors: 2
pro_smile: CNc1ccc(nn1)C(=O)Nc2cccc(c2Cl)Cl
InChi: InChI=1S/C12H10Cl2N4O/c1-15-10-6-5-9(17-18-10)12(19)16-8-4-2-3-7(13)11(8)14/h2-6H,1H3,(H,15,18)(H,16,19)
InChiKey: InChIKey=BARBUAVKDJIYNT-UHFFFAOYSA-N