N-[(4-FLUOROPHENYL)METHYL]-6-(METHYLAMINO)PYRIDAZINE-3-CARBOXAMIDE

pro_cas
pro_cdbregno
CCD03316646
pro_formula
C13 H13 F N4 O
pro_molWeight
260.271

basic_info

Product_Name: N-[(4-FLUOROPHENYL)METHYL]-6-(METHYLAMINO)PYRIDAZINE-3-CARBOXAMIDE
EnglishSynonyms: N-[(4-FLUOROPHENYL)METHYL]-6-(METHYLAMINO)PYRIDAZINE-3-CARBOXAMIDE
pro_mdlNumber: MFCD17037242
pro_acceptors: 5
pro_donors: 2
pro_smile: CNc1ccc(nn1)C(=O)NCc2ccc(cc2)F
InChi: InChI=1S/C13H13FN4O/c1-15-12-7-6-11(17-18-12)13(19)16-8-9-2-4-10(14)5-3-9/h2-7H,8H2,1H3,(H,15,18)(H,16,19)
InChiKey: InChIKey=WIUQJKZHYKROJU-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.