2-[(2-FLUOROPHENYL)AMINO]-2-(OXAN-4-YL)ETHAN-1-OL

pro_cas
pro_cdbregno
CCD03341852
pro_formula
C13 H18 F N O2
pro_molWeight
239.288

basic_info

Product_Name: 2-[(2-FLUOROPHENYL)AMINO]-2-(OXAN-4-YL)ETHAN-1-OL
EnglishSynonyms: 2-[(2-FLUOROPHENYL)AMINO]-2-(OXAN-4-YL)ETHAN-1-OL
pro_mdlNumber: MFCD17063575
pro_acceptors: 3
pro_donors: 2
pro_smile: c1ccc(c(c1)NC(CO)C2CCOCC2)F
InChi: InChI=1S/C13H18FNO2/c14-11-3-1-2-4-12(11)15-13(9-16)10-5-7-17-8-6-10/h1-4,10,13,15-16H,5-9H2
InChiKey: InChIKey=QMGAXYPRFBJSQM-UHFFFAOYSA-N