4-[3-(4-METHOXYPHENYL)PROPYL]PIPERIDINE

pro_cas
pro_cdbregno
CCD03347419
pro_formula
C15 H23 N O
pro_molWeight
233.353

basic_info

Product_Name: 4-[3-(4-METHOXYPHENYL)PROPYL]PIPERIDINE
EnglishSynonyms: 4-[3-(4-METHOXYPHENYL)PROPYL]PIPERIDINE
pro_mdlNumber: MFCD17069615
pro_acceptors: 2
pro_donors: 1
pro_smile: COc1ccc(cc1)CCCC2CCNCC2
InChi: InChI=1S/C15H23NO/c1-17-15-7-5-13(6-8-15)3-2-4-14-9-11-16-12-10-14/h5-8,14,16H,2-4,9-12H2,1H3
InChiKey: InChIKey=WGVPSALPIAOFFL-UHFFFAOYSA-N