3-AMINO-4-[3-(PROPAN-2-YL)-1H-PYRAZOL-1-YL]BENZAMIDE

pro_cas
pro_cdbregno
CCD03367283
pro_formula
C13 H16 N4 O
pro_molWeight
244.296

basic_info

Product_Name: 3-AMINO-4-[3-(PROPAN-2-YL)-1H-PYRAZOL-1-YL]BENZAMIDE
EnglishSynonyms: 3-AMINO-4-[3-(PROPAN-2-YL)-1H-PYRAZOL-1-YL]BENZAMIDE
pro_mdlNumber: MFCD17099510
pro_acceptors: 5
pro_donors: 2
pro_smile: CC(C)c1ccn(n1)c2ccc(cc2N)C(=O)N
InChi: InChI=1S/C13H16N4O/c1-8(2)11-5-6-17(16-11)12-4-3-9(13(15)18)7-10(12)14/h3-8H,14H2,1-2H3,(H2,15,18)
InChiKey: InChIKey=RPRKOUQDACDQNF-UHFFFAOYSA-N