N-[1-(ETHANESULFONYL)PIPERIDIN-4-YL]-3-(ETHYLAMINO)PROPANAMIDE

pro_cas
pro_cdbregno
CCD03397997
pro_formula
C12 H25 N3 O3 S
pro_molWeight
291.414

basic_info

Product_Name: N-[1-(ETHANESULFONYL)PIPERIDIN-4-YL]-3-(ETHYLAMINO)PROPANAMIDE
EnglishSynonyms: N-[1-(ETHANESULFONYL)PIPERIDIN-4-YL]-3-(ETHYLAMINO)PROPANAMIDE
pro_mdlNumber: MFCD17132068
pro_acceptors: 6
pro_donors: 2
pro_smile: CCNCCC(=O)NC1CCN(CC1)S(=O)(=O)CC
InChi: InChI=1S/C12H25N3O3S/c1-3-13-8-5-12(16)14-11-6-9-15(10-7-11)19(17,18)4-2/h11,13H,3-10H2,1-2H3,(H,14,16)
InChiKey: InChIKey=DBLKYVMLEDPCOX-UHFFFAOYSA-N