6-(3-ETHYL-1H-1,2,4-TRIAZOL-5-YL)QUINOLINE

pro_cas
pro_cdbregno
CCD03399510
pro_formula
C13 H12 N4
pro_molWeight
224.266

basic_info

Product_Name: 6-(3-ETHYL-1H-1,2,4-TRIAZOL-5-YL)QUINOLINE
EnglishSynonyms: 6-(3-ETHYL-1H-1,2,4-TRIAZOL-5-YL)QUINOLINE
pro_mdlNumber: MFCD17133682
pro_acceptors: 4
pro_donors: 1
pro_smile: CCc1nc([nH]n1)c2ccc3c(c2)cccn3
InChi: InChI=1S/C13H12N4/c1-2-12-15-13(17-16-12)10-5-6-11-9(8-10)4-3-7-14-11/h3-8H,2H2,1H3,(H,15,16,17)
InChiKey: InChIKey=KUMVWPGTWDMBCZ-UHFFFAOYSA-N