KINGSHCHEM 67613

pro_cas
pro_cdbregno
CCD03474763
pro_formula
C15 H11 Cl F N S
pro_molWeight
291.776

basic_info

Product_Name: KINGSHCHEM 67613
EnglishSynonyms: KINGSHCHEM 67613
pro_mdlNumber: MFCD17212201
pro_acceptors: 1
pro_donors: 0
pro_smile: Cc1cc(c2c(c1)sc(n2)c3c(cccc3Cl)F)C
InChi: InChI=1S/C15H11ClFNS/c1-8-6-9(2)14-12(7-8)19-15(18-14)13-10(16)4-3-5-11(13)17/h3-7H,1-2H3
InChiKey: InChIKey=NVFBSYJBHNTZMD-UHFFFAOYSA-N