KINGSHCHEM 67879

pro_cas
pro_cdbregno
CCD03475029
pro_formula
C11 H5 Cl F N O S
pro_molWeight
253.684

basic_info

Product_Name: KINGSHCHEM 67879
EnglishSynonyms: KINGSHCHEM 67879
pro_mdlNumber: MFCD17212467
pro_acceptors: 2
pro_donors: 0
pro_smile: c1cc(oc1)c2nc3c(s2)ccc(c3F)Cl
InChi: InChI=1S/C11H5ClFNOS/c12-6-3-4-8-10(9(6)13)14-11(16-8)7-2-1-5-15-7/h1-5H
InChiKey: InChIKey=CTUKXFSCXOCCGC-UHFFFAOYSA-N