KINGSHCHEM 10907

pro_cas
pro_cdbregno
CCD03475032
pro_formula
C10 H10 Br N3 . 2 Cl H
pro_molWeight
325.036

basic_info

Product_Name: KINGSHCHEM 10907
EnglishSynonyms: KINGSHCHEM 10907
pro_mdlNumber: MFCD17212470
pro_acceptors: 3
pro_donors: 2
pro_smile: c1cc(ccc1c2cnc([nH]2)CN)Br.Cl.Cl
InChi: InChI=1S/C10H10BrN3.2ClH/c11-8-3-1-7(2-4-8)9-6-13-10(5-12)14-9;;/h1-4,6H,5,12H2,(H,13,14);2*1H
InChiKey: InChIKey=BRLVZOJIPWDOBB-UHFFFAOYSA-N