KINGSHCHEM 10920

pro_cas
pro_cdbregno
CCD03475033
pro_formula
C16 H27 Cl O2 Si
pro_molWeight
314.926

basic_info

Product_Name: KINGSHCHEM 10920
EnglishSynonyms: KINGSHCHEM 10920
pro_mdlNumber: MFCD17212471
pro_acceptors: 2
pro_donors: 1
pro_smile: CC(C)(C)[Si](C)(C)OC(CCCO)c1ccccc1Cl
InChi: InChI=1S/C16H27ClO2Si/c1-16(2,3)20(4,5)19-15(11-8-12-18)13-9-6-7-10-14(13)17/h6-7,9-10,15,18H,8,11-12H2,1-5H3
InChiKey: InChIKey=MKFLFMIDYXLIQV-UHFFFAOYSA-N