5-CHLORO-2-[4-(CYCLOPROPYLMETHYL)PIPERAZIN-1-YL]BENZONITRILE

pro_cas
pro_cdbregno
CCD03607644
pro_formula
C15 H18 Cl N3
pro_molWeight
275.781

basic_info

Product_Name: 5-CHLORO-2-[4-(CYCLOPROPYLMETHYL)PIPERAZIN-1-YL]BENZONITRILE
EnglishSynonyms: 5-CHLORO-2-[4-(CYCLOPROPYLMETHYL)PIPERAZIN-1-YL]BENZONITRILE
pro_mdlNumber: MFCD17349895
pro_acceptors: 3
pro_donors: 0
pro_smile: c1cc(c(cc1Cl)C#N)N2CCN(CC2)CC3CC3
InChi: InChI=1S/C15H18ClN3/c16-14-3-4-15(13(9-14)10-17)19-7-5-18(6-8-19)11-12-1-2-12/h3-4,9,12H,1-2,5-8,11H2
InChiKey: InChIKey=INQXUTGVUGHSLL-UHFFFAOYSA-N