3-([(3-CHLOROPHENYL)METHYL]AMINO)-1-METHYL-1,2-DIHYDROPYRAZIN-2-ONE

pro_cas
pro_cdbregno
CCD03662619
pro_formula
C12 H12 Cl N3 O
pro_molWeight
249.7

basic_info

Product_Name: 3-([(3-CHLOROPHENYL)METHYL]AMINO)-1-METHYL-1,2-DIHYDROPYRAZIN-2-ONE
EnglishSynonyms: 3-([(3-CHLOROPHENYL)METHYL]AMINO)-1-METHYL-1,2-DIHYDROPYRAZIN-2-ONE
pro_mdlNumber: MFCD17407336
pro_acceptors: 4
pro_donors: 1
pro_smile: Cn1ccnc(c1=O)NCc2cccc(c2)Cl
InChi: InChI=1S/C12H12ClN3O/c1-16-6-5-14-11(12(16)17)15-8-9-3-2-4-10(13)7-9/h2-7H,8H2,1H3,(H,14,15)
InChiKey: InChIKey=UUPRGJBAPJRCGV-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.