2-([(4,4-DIMETHYLPIPERIDIN-1-YL)CARBONYL]AMINO)-3-METHYLBUTANOIC ACID

pro_cas
pro_cdbregno
CCD03664650
pro_formula
C13 H24 N2 O3
pro_molWeight
256.344

basic_info

Product_Name: 2-([(4,4-DIMETHYLPIPERIDIN-1-YL)CARBONYL]AMINO)-3-METHYLBUTANOIC ACID
EnglishSynonyms: 2-([(4,4-DIMETHYLPIPERIDIN-1-YL)CARBONYL]AMINO)-3-METHYLBUTANOIC ACID
pro_mdlNumber: MFCD17409446
pro_acceptors: 5
pro_donors: 2
pro_smile: CC(C)C(C(=O)O)NC(=O)N1CCC(CC1)(C)C
InChi: InChI=1S/C13H24N2O3/c1-9(2)10(11(16)17)14-12(18)15-7-5-13(3,4)6-8-15/h9-10H,5-8H2,1-4H3,(H,14,18)(H,16,17)
InChiKey: InChIKey=NSPHVENPPYXBGQ-UHFFFAOYSA-N