3-(([(ETHYLCARBAMOYL)METHYL]CARBAMOYL)AMINO)CYCLOHEXANE-1-CARBOXYLIC ACID

pro_cas
pro_cdbregno
CCD03678276
pro_formula
C12 H21 N3 O4
pro_molWeight
271.315

basic_info

Product_Name: 3-(([(ETHYLCARBAMOYL)METHYL]CARBAMOYL)AMINO)CYCLOHEXANE-1-CARBOXYLIC ACID
EnglishSynonyms: 3-(([(ETHYLCARBAMOYL)METHYL]CARBAMOYL)AMINO)CYCLOHEXANE-1-CARBOXYLIC ACID
pro_mdlNumber: MFCD17423819
pro_acceptors: 7
pro_donors: 4
pro_smile: CCNC(=O)CNC(=O)NC1CCCC(C1)C(=O)O
InChi: InChI=1S/C12H21N3O4/c1-2-13-10(16)7-14-12(19)15-9-5-3-4-8(6-9)11(17)18/h8-9H,2-7H2,1H3,(H,13,16)(H,17,18)(H2,14,15,19)
InChiKey: InChIKey=GHXHWGFBIACUBO-UHFFFAOYSA-N