N-[3-(CYCLOHEXYLAMINO)PROPYL]-4-FLUORO-N-METHYLANILINE

pro_cas
pro_cdbregno
CCD03686129
pro_formula
C16 H25 F N2
pro_molWeight
264.385

basic_info

Product_Name: N-[3-(CYCLOHEXYLAMINO)PROPYL]-4-FLUORO-N-METHYLANILINE
EnglishSynonyms: N-[3-(CYCLOHEXYLAMINO)PROPYL]-4-FLUORO-N-METHYLANILINE
pro_mdlNumber: MFCD17432247
pro_acceptors: 2
pro_donors: 1
pro_smile: CN(CCCNC1CCCCC1)c2ccc(cc2)F
InChi: InChI=1S/C16H25FN2/c1-19(16-10-8-14(17)9-11-16)13-5-12-18-15-6-3-2-4-7-15/h8-11,15,18H,2-7,12-13H2,1H3
InChiKey: InChIKey=CAYDGEVNRDXUFM-UHFFFAOYSA-N