3-METHYL-2-([(4-PROPYLPIPERIDIN-1-YL)CARBONYL]AMINO)BUTANOIC ACID

pro_cas
pro_cdbregno
CCD03705597
pro_formula
C14 H26 N2 O3
pro_molWeight
270.37

basic_info

Product_Name: 3-METHYL-2-([(4-PROPYLPIPERIDIN-1-YL)CARBONYL]AMINO)BUTANOIC ACID
EnglishSynonyms: 3-METHYL-2-([(4-PROPYLPIPERIDIN-1-YL)CARBONYL]AMINO)BUTANOIC ACID
pro_mdlNumber: MFCD17452418
pro_acceptors: 5
pro_donors: 2
pro_smile: CCCC1CCN(CC1)C(=O)NC(C(C)C)C(=O)O
InChi: InChI=1S/C14H26N2O3/c1-4-5-11-6-8-16(9-7-11)14(19)15-12(10(2)3)13(17)18/h10-12H,4-9H2,1-3H3,(H,15,19)(H,17,18)
InChiKey: InChIKey=HDLCADBLGYORCE-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.