6-[(ETHYLAMINO)METHYL]-N-METHYL-N-(THIOPHEN-2-YLMETHYL)PYRIDIN-2-AMINE

pro_cas
pro_cdbregno
CCD03715409
pro_formula
C14 H19 N3 S
pro_molWeight
261.391

basic_info

Product_Name: 6-[(ETHYLAMINO)METHYL]-N-METHYL-N-(THIOPHEN-2-YLMETHYL)PYRIDIN-2-AMINE
EnglishSynonyms: 6-[(ETHYLAMINO)METHYL]-N-METHYL-N-(THIOPHEN-2-YLMETHYL)PYRIDIN-2-AMINE
pro_mdlNumber: MFCD17462513
pro_acceptors: 3
pro_donors: 1
pro_smile: CCNCc1cccc(n1)N(C)Cc2cccs2
InChi: InChI=1S/C14H19N3S/c1-3-15-10-12-6-4-8-14(16-12)17(2)11-13-7-5-9-18-13/h4-9,15H,3,10-11H2,1-2H3
InChiKey: InChIKey=ZOBPSZPUHUPYEL-UHFFFAOYSA-N