8-[4-(FURAN-2-YL)BUTAN-2-YL]-N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE

pro_cas
pro_cdbregno
CCD03776334
pro_formula
C16 H26 N2 O
pro_molWeight
262.394

basic_info

Product_Name: 8-[4-(FURAN-2-YL)BUTAN-2-YL]-N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
EnglishSynonyms: 8-[4-(FURAN-2-YL)BUTAN-2-YL]-N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
pro_mdlNumber: MFCD17525666
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(CCc1ccco1)N2C3CCC2CC(C3)NC
InChi: InChI=1S/C16H26N2O/c1-12(5-8-16-4-3-9-19-16)18-14-6-7-15(18)11-13(10-14)17-2/h3-4,9,12-15,17H,5-8,10-11H2,1-2H3
InChiKey: InChIKey=BUCVMQAPCINMPR-UHFFFAOYSA-N