ZERENEX ZXW005738

pro_cas
pro_cdbregno
CCD03788866
pro_formula
C14 H10 Cl2 N2 O S
pro_molWeight
325.218

basic_info

Product_Name: ZERENEX ZXW005738
EnglishSynonyms: ZERENEX ZXW005738
pro_mdlNumber: MFCD17563487
pro_acceptors: 3
pro_donors: 0
pro_smile: c1ccc2c(c1)N(CCS2)C(=O)c3c(ccc(n3)Cl)Cl
InChi: InChI=1S/C14H10Cl2N2OS/c15-9-5-6-12(16)17-13(9)14(19)18-7-8-20-11-4-2-1-3-10(11)18/h1-6H,7-8H2
InChiKey: InChIKey=IBDZJAHTIANPME-UHFFFAOYSA-N