CHEMMAKER BCB-67303

pro_cas
pro_cdbregno
CCD04194714
pro_formula
C15 H22 B N O2
pro_molWeight
259.155

basic_info

Product_Name: CHEMMAKER BCB-67303
EnglishSynonyms: CHEMMAKER BCB-67303
pro_mdlNumber: MFCD18439514
pro_acceptors: 3
pro_donors: 1
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2cccc(c2)C3(CC3)N
InChi: InChI=1S/C15H22BNO2/c1-13(2)14(3,4)19-16(18-13)12-7-5-6-11(10-12)15(17)8-9-15/h5-7,10H,8-9,17H2,1-4H3
InChiKey: InChIKey=IONWEKMPZYNBPE-UHFFFAOYSA-N