CHEMMAKER BCB-67298

pro_cas
pro_cdbregno
CCD04195068
pro_formula
C14 H21 B N2 O2
pro_molWeight
260.143

basic_info

Product_Name: CHEMMAKER BCB-67298
EnglishSynonyms: CHEMMAKER BCB-67298
pro_mdlNumber: MFCD18439868
pro_acceptors: 4
pro_donors: 1
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2cccnc2C3(CC3)N
InChi: InChI=1S/C14H21BN2O2/c1-12(2)13(3,4)19-15(18-12)10-6-5-9-17-11(10)14(16)7-8-14/h5-6,9H,7-8,16H2,1-4H3
InChiKey: InChIKey=JAJUQCMGOUICHB-UHFFFAOYSA-N