CHEMMAKER BCB-18060

pro_cas
pro_cdbregno
CCD04195212
pro_formula
C14 H20 B Cl N2 O2
pro_molWeight
294.588

basic_info

Product_Name: CHEMMAKER BCB-18060
EnglishSynonyms: CHEMMAKER BCB-18060
pro_mdlNumber: MFCD18440012
pro_acceptors: 4
pro_donors: 1
pro_smile: B1(OC(C(O1)(C)C)(C)C)c2ccnc(c2C3(CC3)N)Cl
InChi: InChI=1S/C14H20BClN2O2/c1-12(2)13(3,4)20-15(19-12)9-5-8-18-11(16)10(9)14(17)6-7-14/h5,8H,6-7,17H2,1-4H3
InChiKey: InChIKey=ZYJQRSVZZILLFZ-UHFFFAOYSA-N