2-(2-METHOXY-PHENYL)-PROPIONIC ACID ETHYL ESTER

pro_cas
128950-12-9
pro_cdbregno
CCD04557935
pro_formula
C12 H16 O3
pro_molWeight
208.255

basic_info

Product_Name: 2-(2-METHOXY-PHENYL)-PROPIONIC ACID ETHYL ESTER
CAS: 128950-12-9
EnglishSynonyms: 2-METHOXY-ALPHA-METHYL-BENZENEACETIC ACID, ETHYL ESTER ; 2-(2-METHOXY-PHENYL)-PROPIONIC ACID ETHYL ESTER ; BENZENEACETIC ACID, 2-METHOXY-ALPHA-METHYL-, ETHYL ESTER
pro_mdlNumber: MFCD18909030
pro_acceptors: 3
pro_donors: 0
pro_smile: CCOC(=O)C(C)c1ccccc1OC
InChi: InChI=1S/C12H16O3/c1-4-15-12(13)9(2)10-7-5-6-8-11(10)14-3/h5-9H,4H2,1-3H3
InChiKey: InChIKey=DYJYWKCEISRMBA-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.